C34H36F12N2 — CID 172550429
4-[6-[4-amino-3,5-di(cyclobutyl)phenyl]-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl]-2,6-di(cyclobutyl)aniline (PubChem CID 172550429) has the molecular formula C34H36F12N2 and a molecular weight of 700.65 g/mol. Its IUPAC name is 4-[6-[4-amino-3,5-di(cyclobutyl)phenyl]-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl]-2,6-di(cyclobutyl)aniline.
| Compound Name | 4-[6-[4-amino-3,5-di(cyclobutyl)phenyl]-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl]-2,6-di(cyclobutyl)aniline |
|---|---|
| PubChem CID | 172550429 |
| Molecular Formula | C34H36F12N2 |
| Molecular Weight | 700.65 g/mol |
| Exact Mass | 700.27 |
| IUPAC Name | 4-[6-[4-amino-3,5-di(cyclobutyl)phenyl]-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl]-2,6-di(cyclobutyl)aniline |
| SMILES | Nc1c(C2CCC2)cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c2cc(C3CCC3)c(N)c(C3CCC3)c2)cc1C1CCC1 |
| InChI | InChI=1S/C34H36F12N2/c35-29(36,21-13-23(17-5-1-6-17)27(47)24(14-21)18-7-2-8-18)31(39,40)33(43,44)34(45,46)32(41,42)30(37,38)22-15-25(19-9-3-10-19)28(48)26(16-22)20-11-4-12-20/h13-20H,1-12,47-48H2 |
| InChIKey | FWNYOGVJMPGLIX-UHFFFAOYSA-N |
| XLogP | 11.35 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.65 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|