C32H36F12N2 — CID 172550470
4-[6-(4-amino-3-tert-butyl-5-cyclopropylphenyl)-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl]-2-tert-butyl-6-cyclopropylaniline (PubChem CID 172550470) has the molecular formula C32H36F12N2 and a molecular weight of 676.63 g/mol. Its IUPAC name is 4-[6-(4-amino-3-tert-butyl-5-cyclopropylphenyl)-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl]-2-tert-butyl-6-cyclopropylaniline.
| Compound Name | 4-[6-(4-amino-3-tert-butyl-5-cyclopropylphenyl)-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl]-2-tert-butyl-6-cyclopropylaniline |
|---|---|
| PubChem CID | 172550470 |
| Molecular Formula | C32H36F12N2 |
| Molecular Weight | 676.63 g/mol |
| Exact Mass | 676.27 |
| IUPAC Name | 4-[6-(4-amino-3-tert-butyl-5-cyclopropylphenyl)-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl]-2-tert-butyl-6-cyclopropylaniline |
| SMILES | CC(C)(C)c1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c2cc(C3CC3)c(N)c(C(C)(C)C)c2)cc(C2CC2)c1N |
| InChI | InChI=1S/C32H36F12N2/c1-25(2,3)21-13-17(11-19(23(21)45)15-7-8-15)27(33,34)29(37,38)31(41,42)32(43,44)30(39,40)28(35,36)18-12-20(16-9-10-16)24(46)22(14-18)26(4,5)6/h11-16H,7-10,45-46H2,1-6H3 |
| InChIKey | KPPXBLHCKHKOPU-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.63 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|