C28H28F12N2 — CID 172550510
4-[6-(4-amino-3-cyclobutyl-5-methylphenyl)-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl]-2-cyclobutyl-6-methylaniline (PubChem CID 172550510) has the molecular formula C28H28F12N2 and a molecular weight of 620.52 g/mol. Its IUPAC name is 4-[6-(4-amino-3-cyclobutyl-5-methylphenyl)-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl]-2-cyclobutyl-6-methylaniline.
| Compound Name | 4-[6-(4-amino-3-cyclobutyl-5-methylphenyl)-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl]-2-cyclobutyl-6-methylaniline |
|---|---|
| PubChem CID | 172550510 |
| Molecular Formula | C28H28F12N2 |
| Molecular Weight | 620.52 g/mol |
| Exact Mass | 620.21 |
| IUPAC Name | 4-[6-(4-amino-3-cyclobutyl-5-methylphenyl)-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl]-2-cyclobutyl-6-methylaniline |
| SMILES | Cc1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c2cc(C)c(N)c(C3CCC3)c2)cc(C2CCC2)c1N |
| InChI | InChI=1S/C28H28F12N2/c1-13-9-17(11-19(21(13)41)15-5-3-6-15)23(29,30)25(33,34)27(37,38)28(39,40)26(35,36)24(31,32)18-10-14(2)22(42)20(12-18)16-7-4-8-16/h9-12,15-16H,3-8,41-42H2,1-2H3 |
| InChIKey | CRSZBJAJKORERZ-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.52 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|