C24H46O4Si — CID 172550760
ethyl (3S,5R)-5-[(1R,3aR,4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-hydroxyhexanoate (PubChem CID 172550760) has the molecular formula C24H46O4Si and a molecular weight of 426.71 g/mol. Its IUPAC name is ethyl (3S,5R)-5-[(1R,3aR,4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-hydroxyhexanoate.
| Compound Name | ethyl (3S,5R)-5-[(1R,3aR,4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-hydroxyhexanoate |
|---|---|
| PubChem CID | 172550760 |
| Molecular Formula | C24H46O4Si |
| Molecular Weight | 426.71 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | ethyl (3S,5R)-5-[(1R,3aR,4S,7aR)-7a-methyl-4-triethylsilyloxy-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-3-hydroxyhexanoate |
| SMILES | CCOC(=O)C[C@@H](O)C[C@@H](C)[C@H]1CC[C@H]2[C@@H](O[Si](CC)(CC)CC)CCC[C@]12C |
| InChI | InChI=1S/C24H46O4Si/c1-7-27-23(26)17-19(25)16-18(5)20-13-14-21-22(12-11-15-24(20,21)6)28-29(8-2,9-3)10-4/h18-22,25H,7-17H2,1-6H3/t18-,19+,20-,21+,22+,24-/m1/s1 |
| InChIKey | JXQMSQCXBDRNLJ-PHVPAECOSA-N |
| XLogP | 5.93 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.71 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|