C10H11N3O4 — CID 172551439
ethyl (2Z)-2-hydroxyimino-2-(pyridine-2-carbonylamino)acetate (PubChem CID 172551439) has the molecular formula C10H11N3O4 and a molecular weight of 237.22 g/mol. Its IUPAC name is ethyl (2Z)-2-hydroxyimino-2-(pyridine-2-carbonylamino)acetate.
| Compound Name | ethyl (2Z)-2-hydroxyimino-2-(pyridine-2-carbonylamino)acetate |
|---|---|
| PubChem CID | 172551439 |
| Molecular Formula | C10H11N3O4 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | ethyl (2Z)-2-hydroxyimino-2-(pyridine-2-carbonylamino)acetate |
| SMILES | CCOC(=O)/C(=N/O)NC(=O)c1ccccn1 |
| InChI | InChI=1S/C10H11N3O4/c1-2-17-10(15)8(13-16)12-9(14)7-5-3-4-6-11-7/h3-6,16H,2H2,1H3,(H,12,13,14) |
| InChIKey | CULOOGCQYYSCGB-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|