C18H26F4N4O3SSi — CID 172551692
N-ethyl-N-[(1R)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]-3-(2-trimethylsilylethoxymethyl)triazole-4-sulfonamide (PubChem CID 172551692) has the molecular formula C18H26F4N4O3SSi and a molecular weight of 482.58 g/mol. Its IUPAC name is N-ethyl-N-[(1R)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]-3-(2-trimethylsilylethoxymethyl)triazole-4-sulfonamide.
| Compound Name | N-ethyl-N-[(1R)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]-3-(2-trimethylsilylethoxymethyl)triazole-4-sulfonamide |
|---|---|
| PubChem CID | 172551692 |
| Molecular Formula | C18H26F4N4O3SSi |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | N-ethyl-N-[(1R)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]-3-(2-trimethylsilylethoxymethyl)triazole-4-sulfonamide |
| SMILES | CCN([C@H](c1ccc(F)cc1)C(F)(F)F)S(=O)(=O)c1cnnn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C18H26F4N4O3SSi/c1-5-26(17(18(20,21)22)14-6-8-15(19)9-7-14)30(27,28)16-12-23-24-25(16)13-29-10-11-31(2,3)4/h6-9,12,17H,5,10-11,13H2,1-4H3/t17-/m1/s1 |
| InChIKey | CKURUYFSVXNLDI-QGZVFWFLSA-N |
| XLogP | 4.04 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|