C21H14F3N3O4 — CID 172552386
methyl 2-[(5-oxo-1,2,6-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-6-yl)methyl]-5-(trifluoromethyl)-1-benzofuran-7-carboxylate (PubChem CID 172552386) has the molecular formula C21H14F3N3O4 and a molecular weight of 429.35 g/mol. Its IUPAC name is methyl 2-[(5-oxo-1,2,6-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-6-yl)methyl]-5-(trifluoromethyl)-1-benzofuran-7-carboxylate.
| Compound Name | methyl 2-[(5-oxo-1,2,6-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-6-yl)methyl]-5-(trifluoromethyl)-1-benzofuran-7-carboxylate |
|---|---|
| PubChem CID | 172552386 |
| Molecular Formula | C21H14F3N3O4 |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | methyl 2-[(5-oxo-1,2,6-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-6-yl)methyl]-5-(trifluoromethyl)-1-benzofuran-7-carboxylate |
| SMILES | COC(=O)c1cc(C(F)(F)F)cc2cc(CN3Cc4cccn5ncc(c45)C3=O)oc12 |
| InChI | InChI=1S/C21H14F3N3O4/c1-30-20(29)15-7-13(21(22,23)24)5-12-6-14(31-18(12)15)10-26-9-11-3-2-4-27-17(11)16(8-25-27)19(26)28/h2-8H,9-10H2,1H3 |
| InChIKey | NLCDWQTVTLPMFQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |