C20H13ClFN3O4 — CID 172552387
methyl 3-chloro-5-fluoro-2-[(5-oxo-1,2,6-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-6-yl)methyl]-1-benzofuran-7-carboxylate (PubChem CID 172552387) has the molecular formula C20H13ClFN3O4 and a molecular weight of 413.79 g/mol. Its IUPAC name is methyl 3-chloro-5-fluoro-2-[(5-oxo-1,2,6-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-6-yl)methyl]-1-benzofuran-7-carboxylate.
| Compound Name | methyl 3-chloro-5-fluoro-2-[(5-oxo-1,2,6-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-6-yl)methyl]-1-benzofuran-7-carboxylate |
|---|---|
| PubChem CID | 172552387 |
| Molecular Formula | C20H13ClFN3O4 |
| Molecular Weight | 413.79 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | methyl 3-chloro-5-fluoro-2-[(5-oxo-1,2,6-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-6-yl)methyl]-1-benzofuran-7-carboxylate |
| SMILES | COC(=O)c1cc(F)cc2c(Cl)c(CN3Cc4cccn5ncc(c45)C3=O)oc12 |
| InChI | InChI=1S/C20H13ClFN3O4/c1-28-20(27)13-6-11(22)5-12-16(21)15(29-18(12)13)9-24-8-10-3-2-4-25-17(10)14(7-23-25)19(24)26/h2-7H,8-9H2,1H3 |
| InChIKey | WJAUXFNETUJMNK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.79 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |