C19H11F2N3O4 — CID 172552404
4,5-difluoro-2-[(5-oxo-1,2,6-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-6-yl)methyl]-1-benzofuran-7-carboxylic acid (PubChem CID 172552404) has the molecular formula C19H11F2N3O4 and a molecular weight of 383.31 g/mol. Its IUPAC name is 4,5-difluoro-2-[(5-oxo-1,2,6-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-6-yl)methyl]-1-benzofuran-7-carboxylic acid.
| Compound Name | 4,5-difluoro-2-[(5-oxo-1,2,6-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-6-yl)methyl]-1-benzofuran-7-carboxylic acid |
|---|---|
| PubChem CID | 172552404 |
| Molecular Formula | C19H11F2N3O4 |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 4,5-difluoro-2-[(5-oxo-1,2,6-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-6-yl)methyl]-1-benzofuran-7-carboxylic acid |
| SMILES | O=C(O)c1cc(F)c(F)c2cc(CN3Cc4cccn5ncc(c45)C3=O)oc12 |
| InChI | InChI=1S/C19H11F2N3O4/c20-14-5-12(19(26)27)17-11(15(14)21)4-10(28-17)8-23-7-9-2-1-3-24-16(9)13(6-22-24)18(23)25/h1-6H,7-8H2,(H,26,27) |
| InChIKey | RPZHOGSOPNJWJM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |