C20H14FN3O4 — CID 172552413
methyl 5-fluoro-2-[(5-oxo-1,2,6-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-6-yl)methyl]-1-benzofuran-7-carboxylate (PubChem CID 172552413) has the molecular formula C20H14FN3O4 and a molecular weight of 379.35 g/mol. Its IUPAC name is methyl 5-fluoro-2-[(5-oxo-1,2,6-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-6-yl)methyl]-1-benzofuran-7-carboxylate.
| Compound Name | methyl 5-fluoro-2-[(5-oxo-1,2,6-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-6-yl)methyl]-1-benzofuran-7-carboxylate |
|---|---|
| PubChem CID | 172552413 |
| Molecular Formula | C20H14FN3O4 |
| Molecular Weight | 379.35 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | methyl 5-fluoro-2-[(5-oxo-1,2,6-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-6-yl)methyl]-1-benzofuran-7-carboxylate |
| SMILES | COC(=O)c1cc(F)cc2cc(CN3Cc4cccn5ncc(c45)C3=O)oc12 |
| InChI | InChI=1S/C20H14FN3O4/c1-27-20(26)15-7-13(21)5-12-6-14(28-18(12)15)10-23-9-11-3-2-4-24-17(11)16(8-22-24)19(23)25/h2-8H,9-10H2,1H3 |
| InChIKey | OFIPYOJSWVFBSE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |