C21H16N4O5 — CID 172552416
methyl 5-carbamoyl-2-[(5-oxo-1,2,6-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-6-yl)methyl]-1-benzofuran-7-carboxylate (PubChem CID 172552416) has the molecular formula C21H16N4O5 and a molecular weight of 404.38 g/mol. Its IUPAC name is methyl 5-carbamoyl-2-[(5-oxo-1,2,6-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-6-yl)methyl]-1-benzofuran-7-carboxylate.
| Compound Name | methyl 5-carbamoyl-2-[(5-oxo-1,2,6-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-6-yl)methyl]-1-benzofuran-7-carboxylate |
|---|---|
| PubChem CID | 172552416 |
| Molecular Formula | C21H16N4O5 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | methyl 5-carbamoyl-2-[(5-oxo-1,2,6-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),8,10-tetraen-6-yl)methyl]-1-benzofuran-7-carboxylate |
| SMILES | COC(=O)c1cc(C(N)=O)cc2cc(CN3Cc4cccn5ncc(c45)C3=O)oc12 |
| InChI | InChI=1S/C21H16N4O5/c1-29-21(28)15-7-13(19(22)26)5-12-6-14(30-18(12)15)10-24-9-11-3-2-4-25-17(11)16(8-23-25)20(24)27/h2-8H,9-10H2,1H3,(H2,22,26) |
| InChIKey | MAMAAXRIALUOKK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 120.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |