About ethyl N-[[2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrol-5-yl]amino]carbamate
ethyl N-[[2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrol-5-yl]amino]carbamate (PubChem CID 172552685) has the molecular formula C13H16FN3O2
and a molecular weight of 265.29 g/mol. Its IUPAC name is ethyl N-[[2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrol-5-yl]amino]carbamate.
Molecular Properties
| Compound Name | ethyl N-[[2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrol-5-yl]amino]carbamate |
| PubChem CID | 172552685 |
| Molecular Formula | C13H16FN3O2 |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | ethyl N-[[2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrol-5-yl]amino]carbamate |
| SMILES | CCOC(=O)NNC1=NC(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C13H16FN3O2/c1-2-19-13(18)17-16-12-8-7-11(15-12)9-3-5-10(14)6-4-9/h3-6,11H,2,7-8H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | UBNJWQGOCPMDKJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[[2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrol-5-yl]amino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[[2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrol-5-yl]amino]carbamate?
The IUPAC name of ethyl N-[[2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrol-5-yl]amino]carbamate (CID 172552685) is ethyl N-[[2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrol-5-yl]amino]carbamate.
What is the SMILES notation for ethyl N-[[2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrol-5-yl]amino]carbamate?
The canonical SMILES for ethyl N-[[2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrol-5-yl]amino]carbamate is CCOC(=O)NNC1=NC(c2ccc(F)cc2)CC1.
What is the InChIKey of ethyl N-[[2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrol-5-yl]amino]carbamate?
The InChIKey is UBNJWQGOCPMDKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16FN3O2/c1-2-19-13(18)17-16-12-8-7-11(15-12)9-3-5-10(14)6-4-9/h3-6,11H,2,7-8H2,1H3,(H,15,16)(H,17,18).
What are the key properties of ethyl N-[[2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrol-5-yl]amino]carbamate?
ethyl N-[[2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrol-5-yl]amino]carbamate has a molecular weight of 265.29 g/mol, XLogP of 2.31, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[[2-(4-fluorophenyl)-3,4-dihydro-2H-pyrrol-5-yl]amino]carbamate is sourced from PubChem (CID 172552685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).