C13H14N2O — CID 172552848
2-amino-7,8,9,10-tetrahydro-5H-phenanthridin-6-one (PubChem CID 172552848) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is 2-amino-7,8,9,10-tetrahydro-5H-phenanthridin-6-one.
| Compound Name | 2-amino-7,8,9,10-tetrahydro-5H-phenanthridin-6-one |
|---|---|
| PubChem CID | 172552848 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 2-amino-7,8,9,10-tetrahydro-5H-phenanthridin-6-one |
| SMILES | Nc1ccc2[nH]c(=O)c3c(c2c1)CCCC3 |
| InChI | InChI=1S/C13H14N2O/c14-8-5-6-12-11(7-8)9-3-1-2-4-10(9)13(16)15-12/h5-7H,1-4,14H2,(H,15,16) |
| InChIKey | PFKIIIMLNYPKPI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|