About magnesium methoxymethyl carbonate
magnesium methoxymethyl carbonate (PubChem CID 172553397) has the molecular formula C6H10MgO8
and a molecular weight of 234.44 g/mol. Its IUPAC name is magnesium methoxymethyl carbonate.
Molecular Properties
| Compound Name | magnesium methoxymethyl carbonate |
| PubChem CID | 172553397 |
| Molecular Formula | C6H10MgO8 |
| Molecular Weight | 234.44 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | magnesium methoxymethyl carbonate |
| SMILES | COCOC(=O)[O-].COCOC(=O)[O-].[Mg+2] |
| InChI | InChI=1S/2C3H6O4.Mg/c2*1-6-2-7-3(4)5;/h2*2H2,1H3,(H,4,5);/q;;+2/p-2 |
| InChIKey | YWWZHKFLCOTNQQ-UHFFFAOYSA-L |
| XLogP | -2.48 |
| TPSA | 117.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.44 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze magnesium methoxymethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium methoxymethyl carbonate?
The IUPAC name of magnesium methoxymethyl carbonate (CID 172553397) is magnesium methoxymethyl carbonate.
What is the SMILES notation for magnesium methoxymethyl carbonate?
The canonical SMILES for magnesium methoxymethyl carbonate is COCOC(=O)[O-].COCOC(=O)[O-].[Mg+2].
What is the InChIKey of magnesium methoxymethyl carbonate?
The InChIKey is YWWZHKFLCOTNQQ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C3H6O4.Mg/c2*1-6-2-7-3(4)5;/h2*2H2,1H3,(H,4,5);/q;;+2/p-2.
What are the key properties of magnesium methoxymethyl carbonate?
magnesium methoxymethyl carbonate has a molecular weight of 234.44 g/mol, XLogP of -2.48, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium methoxymethyl carbonate is sourced from PubChem (CID 172553397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).