About trans-(2,5-dioxopyrrolidin-1-yl) (1R,2R)-2-(3-methylphenyl)cyclopropane-1-carboxylate
trans-(2,5-dioxopyrrolidin-1-yl) (1R,2R)-2-(3-methylphenyl)cyclopropane-1-carboxylate (PubChem CID 172554100) has the molecular formula C15H15NO4
and a molecular weight of 273.29 g/mol. Its IUPAC name is trans-(2,5-dioxopyrrolidin-1-yl) (1R,2R)-2-(3-methylphenyl)cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | trans-(2,5-dioxopyrrolidin-1-yl) (1R,2R)-2-(3-methylphenyl)cyclopropane-1-carboxylate |
| PubChem CID | 172554100 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | trans-(2,5-dioxopyrrolidin-1-yl) (1R,2R)-2-(3-methylphenyl)cyclopropane-1-carboxylate |
| SMILES | Cc1cccc([C@@H]2C[C@H]2C(=O)ON2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C15H15NO4/c1-9-3-2-4-10(7-9)11-8-12(11)15(19)20-16-13(17)5-6-14(16)18/h2-4,7,11-12H,5-6,8H2,1H3/t11-,12+/m0/s1 |
| InChIKey | FPMVNKOEKUXOOC-NWDGAFQWSA-N |
| XLogP | 1.71 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze trans-(2,5-dioxopyrrolidin-1-yl) (1R,2R)-2-(3-methylphenyl)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(2,5-dioxopyrrolidin-1-yl) (1R,2R)-2-(3-methylphenyl)cyclopropane-1-carboxylate?
The IUPAC name of trans-(2,5-dioxopyrrolidin-1-yl) (1R,2R)-2-(3-methylphenyl)cyclopropane-1-carboxylate (CID 172554100) is trans-(2,5-dioxopyrrolidin-1-yl) (1R,2R)-2-(3-methylphenyl)cyclopropane-1-carboxylate.
What is the SMILES notation for trans-(2,5-dioxopyrrolidin-1-yl) (1R,2R)-2-(3-methylphenyl)cyclopropane-1-carboxylate?
The canonical SMILES for trans-(2,5-dioxopyrrolidin-1-yl) (1R,2R)-2-(3-methylphenyl)cyclopropane-1-carboxylate is Cc1cccc([C@@H]2C[C@H]2C(=O)ON2C(=O)CCC2=O)c1.
What is the InChIKey of trans-(2,5-dioxopyrrolidin-1-yl) (1R,2R)-2-(3-methylphenyl)cyclopropane-1-carboxylate?
The InChIKey is FPMVNKOEKUXOOC-NWDGAFQWSA-N. The full InChI is InChI=1S/C15H15NO4/c1-9-3-2-4-10(7-9)11-8-12(11)15(19)20-16-13(17)5-6-14(16)18/h2-4,7,11-12H,5-6,8H2,1H3/t11-,12+/m0/s1.
What are the key properties of trans-(2,5-dioxopyrrolidin-1-yl) (1R,2R)-2-(3-methylphenyl)cyclopropane-1-carboxylate?
trans-(2,5-dioxopyrrolidin-1-yl) (1R,2R)-2-(3-methylphenyl)cyclopropane-1-carboxylate has a molecular weight of 273.29 g/mol, XLogP of 1.71, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(2,5-dioxopyrrolidin-1-yl) (1R,2R)-2-(3-methylphenyl)cyclopropane-1-carboxylate is sourced from PubChem (CID 172554100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).