C24H32N2O4 — CID 172554610
1-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]-3-(4-methylpiperazin-1-yl)propan-2-ol (PubChem CID 172554610) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is 1-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]-3-(4-methylpiperazin-1-yl)propan-2-ol.
| Compound Name | 1-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]-3-(4-methylpiperazin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 172554610 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 1-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]-3-(4-methylpiperazin-1-yl)propan-2-ol |
| SMILES | COc1cc(/C=C/c2ccc(OCC(O)CN3CCN(C)CC3)cc2)cc(OC)c1 |
| InChI | InChI=1S/C24H32N2O4/c1-25-10-12-26(13-11-25)17-21(27)18-30-22-8-6-19(7-9-22)4-5-20-14-23(28-2)16-24(15-20)29-3/h4-9,14-16,21,27H,10-13,17-18H2,1-3H3/b5-4+ |
| InChIKey | WKQCXEDFOXZJGA-SNAWJCMRSA-N |
| XLogP | 2.86 |
| TPSA | 54.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|