About [1-(4-methyl-1H-pyrrol-2-yl)cyclohexa-2,4-dien-1-yl]methanol
[1-(4-methyl-1H-pyrrol-2-yl)cyclohexa-2,4-dien-1-yl]methanol (PubChem CID 172555848) has the molecular formula C12H15NO
and a molecular weight of 189.26 g/mol. Its IUPAC name is [1-(4-methyl-1H-pyrrol-2-yl)cyclohexa-2,4-dien-1-yl]methanol.
Molecular Properties
| Compound Name | [1-(4-methyl-1H-pyrrol-2-yl)cyclohexa-2,4-dien-1-yl]methanol |
| PubChem CID | 172555848 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | [1-(4-methyl-1H-pyrrol-2-yl)cyclohexa-2,4-dien-1-yl]methanol |
| SMILES | Cc1c[nH]c(C2(CO)C=CC=CC2)c1 |
| InChI | InChI=1S/C12H15NO/c1-10-7-11(13-8-10)12(9-14)5-3-2-4-6-12/h2-5,7-8,13-14H,6,9H2,1H3 |
| InChIKey | MMTKPZTXJKURFQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [1-(4-methyl-1H-pyrrol-2-yl)cyclohexa-2,4-dien-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-methyl-1H-pyrrol-2-yl)cyclohexa-2,4-dien-1-yl]methanol?
The IUPAC name of [1-(4-methyl-1H-pyrrol-2-yl)cyclohexa-2,4-dien-1-yl]methanol (CID 172555848) is [1-(4-methyl-1H-pyrrol-2-yl)cyclohexa-2,4-dien-1-yl]methanol.
What is the SMILES notation for [1-(4-methyl-1H-pyrrol-2-yl)cyclohexa-2,4-dien-1-yl]methanol?
The canonical SMILES for [1-(4-methyl-1H-pyrrol-2-yl)cyclohexa-2,4-dien-1-yl]methanol is Cc1c[nH]c(C2(CO)C=CC=CC2)c1.
What is the InChIKey of [1-(4-methyl-1H-pyrrol-2-yl)cyclohexa-2,4-dien-1-yl]methanol?
The InChIKey is MMTKPZTXJKURFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO/c1-10-7-11(13-8-10)12(9-14)5-3-2-4-6-12/h2-5,7-8,13-14H,6,9H2,1H3.
What are the key properties of [1-(4-methyl-1H-pyrrol-2-yl)cyclohexa-2,4-dien-1-yl]methanol?
[1-(4-methyl-1H-pyrrol-2-yl)cyclohexa-2,4-dien-1-yl]methanol has a molecular weight of 189.26 g/mol, XLogP of 2.07, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-methyl-1H-pyrrol-2-yl)cyclohexa-2,4-dien-1-yl]methanol is sourced from PubChem (CID 172555848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).