About 5-(1-benzylpyrrolo[3,2-c]pyridin-6-yl)-2,3-dihydroisoindol-1-one
5-(1-benzylpyrrolo[3,2-c]pyridin-6-yl)-2,3-dihydroisoindol-1-one (PubChem CID 172555857) has the molecular formula C22H17N3O
and a molecular weight of 339.40 g/mol. Its IUPAC name is 5-(1-benzylpyrrolo[3,2-c]pyridin-6-yl)-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 5-(1-benzylpyrrolo[3,2-c]pyridin-6-yl)-2,3-dihydroisoindol-1-one |
| PubChem CID | 172555857 |
| Molecular Formula | C22H17N3O |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 5-(1-benzylpyrrolo[3,2-c]pyridin-6-yl)-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NCc2cc(-c3cc4c(ccn4Cc4ccccc4)cn3)ccc21 |
| InChI | InChI=1S/C22H17N3O/c26-22-19-7-6-16(10-18(19)13-24-22)20-11-21-17(12-23-20)8-9-25(21)14-15-4-2-1-3-5-15/h1-12H,13-14H2,(H,24,26) |
| InChIKey | BWSOSLMPKLACRE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(1-benzylpyrrolo[3,2-c]pyridin-6-yl)-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-benzylpyrrolo[3,2-c]pyridin-6-yl)-2,3-dihydroisoindol-1-one?
The IUPAC name of 5-(1-benzylpyrrolo[3,2-c]pyridin-6-yl)-2,3-dihydroisoindol-1-one (CID 172555857) is 5-(1-benzylpyrrolo[3,2-c]pyridin-6-yl)-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 5-(1-benzylpyrrolo[3,2-c]pyridin-6-yl)-2,3-dihydroisoindol-1-one?
The canonical SMILES for 5-(1-benzylpyrrolo[3,2-c]pyridin-6-yl)-2,3-dihydroisoindol-1-one is O=C1NCc2cc(-c3cc4c(ccn4Cc4ccccc4)cn3)ccc21.
What is the InChIKey of 5-(1-benzylpyrrolo[3,2-c]pyridin-6-yl)-2,3-dihydroisoindol-1-one?
The InChIKey is BWSOSLMPKLACRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17N3O/c26-22-19-7-6-16(10-18(19)13-24-22)20-11-21-17(12-23-20)8-9-25(21)14-15-4-2-1-3-5-15/h1-12H,13-14H2,(H,24,26).
What are the key properties of 5-(1-benzylpyrrolo[3,2-c]pyridin-6-yl)-2,3-dihydroisoindol-1-one?
5-(1-benzylpyrrolo[3,2-c]pyridin-6-yl)-2,3-dihydroisoindol-1-one has a molecular weight of 339.40 g/mol, XLogP of 3.99, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-benzylpyrrolo[3,2-c]pyridin-6-yl)-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 172555857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).