C28H25N3O3 — CID 172556068
ethyl N-(1,3,3-triphenyl-2H-4,1,2-benzoxadiazin-7-yl)carbamate (PubChem CID 172556068) has the molecular formula C28H25N3O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is ethyl N-(1,3,3-triphenyl-2H-4,1,2-benzoxadiazin-7-yl)carbamate.
| Compound Name | ethyl N-(1,3,3-triphenyl-2H-4,1,2-benzoxadiazin-7-yl)carbamate |
|---|---|
| PubChem CID | 172556068 |
| Molecular Formula | C28H25N3O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | ethyl N-(1,3,3-triphenyl-2H-4,1,2-benzoxadiazin-7-yl)carbamate |
| SMILES | CCOC(=O)Nc1ccc2c(c1)N(c1ccccc1)NC(c1ccccc1)(c1ccccc1)O2 |
| InChI | InChI=1S/C28H25N3O3/c1-2-33-27(32)29-23-18-19-26-25(20-23)31(24-16-10-5-11-17-24)30-28(34-26,21-12-6-3-7-13-21)22-14-8-4-9-15-22/h3-20,30H,2H2,1H3,(H,29,32) |
| InChIKey | RBGINMGQYSZMRQ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |