About 2,4-dimethyl-3-[2-(2-methylpyrimidin-5-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol
2,4-dimethyl-3-[2-(2-methylpyrimidin-5-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol (PubChem CID 172556509) has the molecular formula C20H18N4O
and a molecular weight of 330.39 g/mol. Its IUPAC name is 2,4-dimethyl-3-[2-(2-methylpyrimidin-5-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol.
Molecular Properties
| Compound Name | 2,4-dimethyl-3-[2-(2-methylpyrimidin-5-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol |
| PubChem CID | 172556509 |
| Molecular Formula | C20H18N4O |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 2,4-dimethyl-3-[2-(2-methylpyrimidin-5-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol |
| SMILES | Cc1ncc(-c2cc3cc(-c4c(C)ccc(O)c4C)cnc3[nH]2)cn1 |
| InChI | InChI=1S/C20H18N4O/c1-11-4-5-18(25)12(2)19(11)15-6-14-7-17(24-20(14)23-8-15)16-9-21-13(3)22-10-16/h4-10,25H,1-3H3,(H,23,24) |
| InChIKey | CNUXOQDACVPLIG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-dimethyl-3-[2-(2-methylpyrimidin-5-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-3-[2-(2-methylpyrimidin-5-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol?
The IUPAC name of 2,4-dimethyl-3-[2-(2-methylpyrimidin-5-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol (CID 172556509) is 2,4-dimethyl-3-[2-(2-methylpyrimidin-5-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol.
What is the SMILES notation for 2,4-dimethyl-3-[2-(2-methylpyrimidin-5-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol?
The canonical SMILES for 2,4-dimethyl-3-[2-(2-methylpyrimidin-5-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol is Cc1ncc(-c2cc3cc(-c4c(C)ccc(O)c4C)cnc3[nH]2)cn1.
What is the InChIKey of 2,4-dimethyl-3-[2-(2-methylpyrimidin-5-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol?
The InChIKey is CNUXOQDACVPLIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4O/c1-11-4-5-18(25)12(2)19(11)15-6-14-7-17(24-20(14)23-8-15)16-9-21-13(3)22-10-16/h4-10,25H,1-3H3,(H,23,24).
What are the key properties of 2,4-dimethyl-3-[2-(2-methylpyrimidin-5-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol?
2,4-dimethyl-3-[2-(2-methylpyrimidin-5-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol has a molecular weight of 330.39 g/mol, XLogP of 4.32, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-3-[2-(2-methylpyrimidin-5-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]phenol is sourced from PubChem (CID 172556509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).