About 3-[7-fluoro-6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]-2,4-dimethylphenol
3-[7-fluoro-6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]-2,4-dimethylphenol (PubChem CID 172556510) has the molecular formula C19H16FN5O
and a molecular weight of 349.37 g/mol. Its IUPAC name is 3-[7-fluoro-6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]-2,4-dimethylphenol.
Molecular Properties
| Compound Name | 3-[7-fluoro-6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]-2,4-dimethylphenol |
| PubChem CID | 172556510 |
| Molecular Formula | C19H16FN5O |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 3-[7-fluoro-6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]-2,4-dimethylphenol |
| SMILES | Cc1ncc(-c2[nH]c3ncc(-c4c(C)ccc(O)c4C)nc3c2F)cn1 |
| InChI | InChI=1S/C19H16FN5O/c1-9-4-5-14(26)10(2)15(9)13-8-23-19-18(24-13)16(20)17(25-19)12-6-21-11(3)22-7-12/h4-8,26H,1-3H3,(H,23,25) |
| InChIKey | FQXYGJVEWDEDIX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[7-fluoro-6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]-2,4-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[7-fluoro-6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]-2,4-dimethylphenol?
The IUPAC name of 3-[7-fluoro-6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]-2,4-dimethylphenol (CID 172556510) is 3-[7-fluoro-6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]-2,4-dimethylphenol.
What is the SMILES notation for 3-[7-fluoro-6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]-2,4-dimethylphenol?
The canonical SMILES for 3-[7-fluoro-6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]-2,4-dimethylphenol is Cc1ncc(-c2[nH]c3ncc(-c4c(C)ccc(O)c4C)nc3c2F)cn1.
What is the InChIKey of 3-[7-fluoro-6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]-2,4-dimethylphenol?
The InChIKey is FQXYGJVEWDEDIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16FN5O/c1-9-4-5-14(26)10(2)15(9)13-8-23-19-18(24-13)16(20)17(25-19)12-6-21-11(3)22-7-12/h4-8,26H,1-3H3,(H,23,25).
What are the key properties of 3-[7-fluoro-6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]-2,4-dimethylphenol?
3-[7-fluoro-6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]-2,4-dimethylphenol has a molecular weight of 349.37 g/mol, XLogP of 3.85, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[7-fluoro-6-(2-methylpyrimidin-5-yl)-5H-pyrrolo[2,3-b]pyrazin-2-yl]-2,4-dimethylphenol is sourced from PubChem (CID 172556510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).