About ethyl 1'-acetyl-3-(3-chlorophenyl)-2'-oxo-2-phenylspiro[4H-imidazole-5,3'-indole]-4-carboxylate
ethyl 1'-acetyl-3-(3-chlorophenyl)-2'-oxo-2-phenylspiro[4H-imidazole-5,3'-indole]-4-carboxylate (PubChem CID 172556786) has the molecular formula C27H22ClN3O4
and a molecular weight of 487.94 g/mol. Its IUPAC name is ethyl 1'-acetyl-3-(3-chlorophenyl)-2'-oxo-2-phenylspiro[4H-imidazole-5,3'-indole]-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1'-acetyl-3-(3-chlorophenyl)-2'-oxo-2-phenylspiro[4H-imidazole-5,3'-indole]-4-carboxylate |
| PubChem CID | 172556786 |
| Molecular Formula | C27H22ClN3O4 |
| Molecular Weight | 487.94 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | ethyl 1'-acetyl-3-(3-chlorophenyl)-2'-oxo-2-phenylspiro[4H-imidazole-5,3'-indole]-4-carboxylate |
| SMILES | CCOC(=O)C1N(c2cccc(Cl)c2)C(c2ccccc2)=NC12C(=O)N(C(C)=O)c1ccccc12 |
| InChI | InChI=1S/C27H22ClN3O4/c1-3-35-25(33)23-27(21-14-7-8-15-22(21)30(17(2)32)26(27)34)29-24(18-10-5-4-6-11-18)31(23)20-13-9-12-19(28)16-20/h4-16,23H,3H2,1-2H3 |
| InChIKey | SLZWXROHIVAPPI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 487.94 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 1'-acetyl-3-(3-chlorophenyl)-2'-oxo-2-phenylspiro[4H-imidazole-5,3'-indole]-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1'-acetyl-3-(3-chlorophenyl)-2'-oxo-2-phenylspiro[4H-imidazole-5,3'-indole]-4-carboxylate?
The IUPAC name of ethyl 1'-acetyl-3-(3-chlorophenyl)-2'-oxo-2-phenylspiro[4H-imidazole-5,3'-indole]-4-carboxylate (CID 172556786) is ethyl 1'-acetyl-3-(3-chlorophenyl)-2'-oxo-2-phenylspiro[4H-imidazole-5,3'-indole]-4-carboxylate.
What is the SMILES notation for ethyl 1'-acetyl-3-(3-chlorophenyl)-2'-oxo-2-phenylspiro[4H-imidazole-5,3'-indole]-4-carboxylate?
The canonical SMILES for ethyl 1'-acetyl-3-(3-chlorophenyl)-2'-oxo-2-phenylspiro[4H-imidazole-5,3'-indole]-4-carboxylate is CCOC(=O)C1N(c2cccc(Cl)c2)C(c2ccccc2)=NC12C(=O)N(C(C)=O)c1ccccc12.
What is the InChIKey of ethyl 1'-acetyl-3-(3-chlorophenyl)-2'-oxo-2-phenylspiro[4H-imidazole-5,3'-indole]-4-carboxylate?
The InChIKey is SLZWXROHIVAPPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H22ClN3O4/c1-3-35-25(33)23-27(21-14-7-8-15-22(21)30(17(2)32)26(27)34)29-24(18-10-5-4-6-11-18)31(23)20-13-9-12-19(28)16-20/h4-16,23H,3H2,1-2H3.
What are the key properties of ethyl 1'-acetyl-3-(3-chlorophenyl)-2'-oxo-2-phenylspiro[4H-imidazole-5,3'-indole]-4-carboxylate?
ethyl 1'-acetyl-3-(3-chlorophenyl)-2'-oxo-2-phenylspiro[4H-imidazole-5,3'-indole]-4-carboxylate has a molecular weight of 487.94 g/mol, XLogP of 4.33, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1'-acetyl-3-(3-chlorophenyl)-2'-oxo-2-phenylspiro[4H-imidazole-5,3'-indole]-4-carboxylate is sourced from PubChem (CID 172556786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).