C23H23NO — CID 172556894
3-(4-methyl-2-pyridinyl)-5,5-diphenylpentan-2-one (PubChem CID 172556894) has the molecular formula C23H23NO and a molecular weight of 329.44 g/mol. Its IUPAC name is 3-(4-methyl-2-pyridinyl)-5,5-diphenylpentan-2-one.
| Compound Name | 3-(4-methyl-2-pyridinyl)-5,5-diphenylpentan-2-one |
|---|---|
| PubChem CID | 172556894 |
| Molecular Formula | C23H23NO |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 3-(4-methyl-2-pyridinyl)-5,5-diphenylpentan-2-one |
| SMILES | CC(=O)C(CC(c1ccccc1)c1ccccc1)c1cc(C)ccn1 |
| InChI | InChI=1S/C23H23NO/c1-17-13-14-24-23(15-17)21(18(2)25)16-22(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-15,21-22H,16H2,1-2H3 |
| InChIKey | OSIOPFGFNBVPGR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |