About 3-[benzyl(2,2-difluoroethyl)amino]-2H-furan-5-one
3-[benzyl(2,2-difluoroethyl)amino]-2H-furan-5-one (PubChem CID 172557430) has the molecular formula C13H13F2NO2
and a molecular weight of 253.25 g/mol. Its IUPAC name is 3-[benzyl(2,2-difluoroethyl)amino]-2H-furan-5-one.
Molecular Properties
| Compound Name | 3-[benzyl(2,2-difluoroethyl)amino]-2H-furan-5-one |
| PubChem CID | 172557430 |
| Molecular Formula | C13H13F2NO2 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 3-[benzyl(2,2-difluoroethyl)amino]-2H-furan-5-one |
| SMILES | O=C1C=C(N(Cc2ccccc2)CC(F)F)CO1 |
| InChI | InChI=1S/C13H13F2NO2/c14-12(15)8-16(11-6-13(17)18-9-11)7-10-4-2-1-3-5-10/h1-6,12H,7-9H2 |
| InChIKey | HGABKXYIXPDCPO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[benzyl(2,2-difluoroethyl)amino]-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[benzyl(2,2-difluoroethyl)amino]-2H-furan-5-one?
The IUPAC name of 3-[benzyl(2,2-difluoroethyl)amino]-2H-furan-5-one (CID 172557430) is 3-[benzyl(2,2-difluoroethyl)amino]-2H-furan-5-one.
What is the SMILES notation for 3-[benzyl(2,2-difluoroethyl)amino]-2H-furan-5-one?
The canonical SMILES for 3-[benzyl(2,2-difluoroethyl)amino]-2H-furan-5-one is O=C1C=C(N(Cc2ccccc2)CC(F)F)CO1.
What is the InChIKey of 3-[benzyl(2,2-difluoroethyl)amino]-2H-furan-5-one?
The InChIKey is HGABKXYIXPDCPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F2NO2/c14-12(15)8-16(11-6-13(17)18-9-11)7-10-4-2-1-3-5-10/h1-6,12H,7-9H2.
What are the key properties of 3-[benzyl(2,2-difluoroethyl)amino]-2H-furan-5-one?
3-[benzyl(2,2-difluoroethyl)amino]-2H-furan-5-one has a molecular weight of 253.25 g/mol, XLogP of 2.19, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[benzyl(2,2-difluoroethyl)amino]-2H-furan-5-one is sourced from PubChem (CID 172557430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).