C23H27FN4O3SSi — CID 172557597
2-[[4-[7-(4-fluoro-2-methoxyphenyl)-4-methoxy-[1,3]thiazolo[4,5-c]pyridin-6-yl]pyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 172557597) has the molecular formula C23H27FN4O3SSi and a molecular weight of 486.65 g/mol. Its IUPAC name is 2-[[4-[7-(4-fluoro-2-methoxyphenyl)-4-methoxy-[1,3]thiazolo[4,5-c]pyridin-6-yl]pyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-[7-(4-fluoro-2-methoxyphenyl)-4-methoxy-[1,3]thiazolo[4,5-c]pyridin-6-yl]pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 172557597 |
| Molecular Formula | C23H27FN4O3SSi |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 2-[[4-[7-(4-fluoro-2-methoxyphenyl)-4-methoxy-[1,3]thiazolo[4,5-c]pyridin-6-yl]pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | COc1cc(F)ccc1-c1c(-c2cnn(COCC[Si](C)(C)C)c2)nc(OC)c2ncsc12 |
| InChI | InChI=1S/C23H27FN4O3SSi/c1-29-18-10-16(24)6-7-17(18)19-20(27-23(30-2)21-22(19)32-13-25-21)15-11-26-28(12-15)14-31-8-9-33(3,4)5/h6-7,10-13H,8-9,14H2,1-5H3 |
| InChIKey | XCIQIVIZLQAHIV-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|