About 5-bromo-1-(2,2,2-trifluoroethyl)pyrazole-3-carbaldehyde
5-bromo-1-(2,2,2-trifluoroethyl)pyrazole-3-carbaldehyde (PubChem CID 172557970) has the molecular formula C6H4BrF3N2O
and a molecular weight of 257.01 g/mol. Its IUPAC name is 5-bromo-1-(2,2,2-trifluoroethyl)pyrazole-3-carbaldehyde.
Molecular Properties
| Compound Name | 5-bromo-1-(2,2,2-trifluoroethyl)pyrazole-3-carbaldehyde |
| PubChem CID | 172557970 |
| Molecular Formula | C6H4BrF3N2O |
| Molecular Weight | 257.01 g/mol |
| Exact Mass | 255.95 |
| IUPAC Name | 5-bromo-1-(2,2,2-trifluoroethyl)pyrazole-3-carbaldehyde |
| SMILES | O=Cc1cc(Br)n(CC(F)(F)F)n1 |
| InChI | InChI=1S/C6H4BrF3N2O/c7-5-1-4(2-13)11-12(5)3-6(8,9)10/h1-2H,3H2 |
| InChIKey | DZXPBXIPIXNMMR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.01 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-1-(2,2,2-trifluoroethyl)pyrazole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-(2,2,2-trifluoroethyl)pyrazole-3-carbaldehyde?
The IUPAC name of 5-bromo-1-(2,2,2-trifluoroethyl)pyrazole-3-carbaldehyde (CID 172557970) is 5-bromo-1-(2,2,2-trifluoroethyl)pyrazole-3-carbaldehyde.
What is the SMILES notation for 5-bromo-1-(2,2,2-trifluoroethyl)pyrazole-3-carbaldehyde?
The canonical SMILES for 5-bromo-1-(2,2,2-trifluoroethyl)pyrazole-3-carbaldehyde is O=Cc1cc(Br)n(CC(F)(F)F)n1.
What is the InChIKey of 5-bromo-1-(2,2,2-trifluoroethyl)pyrazole-3-carbaldehyde?
The InChIKey is DZXPBXIPIXNMMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrF3N2O/c7-5-1-4(2-13)11-12(5)3-6(8,9)10/h1-2H,3H2.
What are the key properties of 5-bromo-1-(2,2,2-trifluoroethyl)pyrazole-3-carbaldehyde?
5-bromo-1-(2,2,2-trifluoroethyl)pyrazole-3-carbaldehyde has a molecular weight of 257.01 g/mol, XLogP of 2.02, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-(2,2,2-trifluoroethyl)pyrazole-3-carbaldehyde is sourced from PubChem (CID 172557970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).