About 2-chloroimidazo[1,2-a]pyridine-6-sulfonamide
2-chloroimidazo[1,2-a]pyridine-6-sulfonamide (PubChem CID 172558031) has the molecular formula C7H6ClN3O2S
and a molecular weight of 231.66 g/mol. Its IUPAC name is 2-chloroimidazo[1,2-a]pyridine-6-sulfonamide.
Molecular Properties
| Compound Name | 2-chloroimidazo[1,2-a]pyridine-6-sulfonamide |
| PubChem CID | 172558031 |
| Molecular Formula | C7H6ClN3O2S |
| Molecular Weight | 231.66 g/mol |
| Exact Mass | 230.99 |
| IUPAC Name | 2-chloroimidazo[1,2-a]pyridine-6-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc2nc(Cl)cn2c1 |
| InChI | InChI=1S/C7H6ClN3O2S/c8-6-4-11-3-5(14(9,12)13)1-2-7(11)10-6/h1-4H,(H2,9,12,13) |
| InChIKey | OTNMUUHCKNWDGZ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.66 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloroimidazo[1,2-a]pyridine-6-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroimidazo[1,2-a]pyridine-6-sulfonamide?
The IUPAC name of 2-chloroimidazo[1,2-a]pyridine-6-sulfonamide (CID 172558031) is 2-chloroimidazo[1,2-a]pyridine-6-sulfonamide.
What is the SMILES notation for 2-chloroimidazo[1,2-a]pyridine-6-sulfonamide?
The canonical SMILES for 2-chloroimidazo[1,2-a]pyridine-6-sulfonamide is NS(=O)(=O)c1ccc2nc(Cl)cn2c1.
What is the InChIKey of 2-chloroimidazo[1,2-a]pyridine-6-sulfonamide?
The InChIKey is OTNMUUHCKNWDGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN3O2S/c8-6-4-11-3-5(14(9,12)13)1-2-7(11)10-6/h1-4H,(H2,9,12,13).
What are the key properties of 2-chloroimidazo[1,2-a]pyridine-6-sulfonamide?
2-chloroimidazo[1,2-a]pyridine-6-sulfonamide has a molecular weight of 231.66 g/mol, XLogP of 0.64, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroimidazo[1,2-a]pyridine-6-sulfonamide is sourced from PubChem (CID 172558031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).