About 4-(2-chloroethoxy)-1,3,2-benzodioxazole
4-(2-chloroethoxy)-1,3,2-benzodioxazole (PubChem CID 172558174) has the molecular formula C8H8ClNO3
and a molecular weight of 201.61 g/mol. Its IUPAC name is 4-(2-chloroethoxy)-1,3,2-benzodioxazole.
Molecular Properties
| Compound Name | 4-(2-chloroethoxy)-1,3,2-benzodioxazole |
| PubChem CID | 172558174 |
| Molecular Formula | C8H8ClNO3 |
| Molecular Weight | 201.61 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | 4-(2-chloroethoxy)-1,3,2-benzodioxazole |
| SMILES | ClCCOc1cccc2c1ONO2 |
| InChI | InChI=1S/C8H8ClNO3/c9-4-5-11-6-2-1-3-7-8(6)13-10-12-7/h1-3,10H,4-5H2 |
| InChIKey | LICAWHXZXWBIIP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.61 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-chloroethoxy)-1,3,2-benzodioxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chloroethoxy)-1,3,2-benzodioxazole?
The IUPAC name of 4-(2-chloroethoxy)-1,3,2-benzodioxazole (CID 172558174) is 4-(2-chloroethoxy)-1,3,2-benzodioxazole.
What is the SMILES notation for 4-(2-chloroethoxy)-1,3,2-benzodioxazole?
The canonical SMILES for 4-(2-chloroethoxy)-1,3,2-benzodioxazole is ClCCOc1cccc2c1ONO2.
What is the InChIKey of 4-(2-chloroethoxy)-1,3,2-benzodioxazole?
The InChIKey is LICAWHXZXWBIIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClNO3/c9-4-5-11-6-2-1-3-7-8(6)13-10-12-7/h1-3,10H,4-5H2.
What are the key properties of 4-(2-chloroethoxy)-1,3,2-benzodioxazole?
4-(2-chloroethoxy)-1,3,2-benzodioxazole has a molecular weight of 201.61 g/mol, XLogP of 1.50, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloroethoxy)-1,3,2-benzodioxazole is sourced from PubChem (CID 172558174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).