C18H17F3N6O2 — CID 172558377
4-[[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]amino]-7-hydrazinyl-2-methylpyrido[2,3-d]pyrimidine-6-carboxylic acid (PubChem CID 172558377) has the molecular formula C18H17F3N6O2 and a molecular weight of 406.37 g/mol. Its IUPAC name is 4-[[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]amino]-7-hydrazinyl-2-methylpyrido[2,3-d]pyrimidine-6-carboxylic acid.
| Compound Name | 4-[[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]amino]-7-hydrazinyl-2-methylpyrido[2,3-d]pyrimidine-6-carboxylic acid |
|---|---|
| PubChem CID | 172558377 |
| Molecular Formula | C18H17F3N6O2 |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 4-[[(1R)-1-[3-(difluoromethyl)-2-fluorophenyl]ethyl]amino]-7-hydrazinyl-2-methylpyrido[2,3-d]pyrimidine-6-carboxylic acid |
| SMILES | Cc1nc(N[C@H](C)c2cccc(C(F)F)c2F)c2cc(C(=O)O)c(NN)nc2n1 |
| InChI | InChI=1S/C18H17F3N6O2/c1-7(9-4-3-5-10(13(9)19)14(20)21)23-15-11-6-12(18(28)29)17(27-22)26-16(11)25-8(2)24-15/h3-7,14H,22H2,1-2H3,(H,28,29)(H2,23,24,25,26,27)/t7-/m1/s1 |
| InChIKey | WWSCMDSWYARPOJ-SSDOTTSWSA-N |
| XLogP | 3.57 |
| TPSA | 126.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|