About (5-oxo-5-phenylmethoxypentyl) 2-butyloctanoate
(5-oxo-5-phenylmethoxypentyl) 2-butyloctanoate (PubChem CID 172558878) has the molecular formula C24H38O4
and a molecular weight of 390.56 g/mol. Its IUPAC name is (5-oxo-5-phenylmethoxypentyl) 2-butyloctanoate.
Molecular Properties
| Compound Name | (5-oxo-5-phenylmethoxypentyl) 2-butyloctanoate |
| PubChem CID | 172558878 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | (5-oxo-5-phenylmethoxypentyl) 2-butyloctanoate |
| SMILES | CCCCCCC(CCCC)C(=O)OCCCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H38O4/c1-3-5-7-11-17-22(16-6-4-2)24(26)27-19-13-12-18-23(25)28-20-21-14-9-8-10-15-21/h8-10,14-15,22H,3-7,11-13,16-20H2,1-2H3 |
| InChIKey | LKSRVZGTGVHSTE-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (5-oxo-5-phenylmethoxypentyl) 2-butyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-oxo-5-phenylmethoxypentyl) 2-butyloctanoate?
The IUPAC name of (5-oxo-5-phenylmethoxypentyl) 2-butyloctanoate (CID 172558878) is (5-oxo-5-phenylmethoxypentyl) 2-butyloctanoate.
What is the SMILES notation for (5-oxo-5-phenylmethoxypentyl) 2-butyloctanoate?
The canonical SMILES for (5-oxo-5-phenylmethoxypentyl) 2-butyloctanoate is CCCCCCC(CCCC)C(=O)OCCCCC(=O)OCc1ccccc1.
What is the InChIKey of (5-oxo-5-phenylmethoxypentyl) 2-butyloctanoate?
The InChIKey is LKSRVZGTGVHSTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H38O4/c1-3-5-7-11-17-22(16-6-4-2)24(26)27-19-13-12-18-23(25)28-20-21-14-9-8-10-15-21/h8-10,14-15,22H,3-7,11-13,16-20H2,1-2H3.
What are the key properties of (5-oxo-5-phenylmethoxypentyl) 2-butyloctanoate?
(5-oxo-5-phenylmethoxypentyl) 2-butyloctanoate has a molecular weight of 390.56 g/mol, XLogP of 6.22, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-oxo-5-phenylmethoxypentyl) 2-butyloctanoate is sourced from PubChem (CID 172558878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).