C14H28N2O2 — CID 172559646
tert-butyl 2-[(1S)-1-aminoethyl]-3-ethylpiperidine-1-carboxylate (PubChem CID 172559646) has the molecular formula C14H28N2O2 and a molecular weight of 256.39 g/mol. Its IUPAC name is tert-butyl 2-[(1S)-1-aminoethyl]-3-ethylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(1S)-1-aminoethyl]-3-ethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 172559646 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | tert-butyl 2-[(1S)-1-aminoethyl]-3-ethylpiperidine-1-carboxylate |
| SMILES | CCC1CCCN(C(=O)OC(C)(C)C)C1[C@H](C)N |
| InChI | InChI=1S/C14H28N2O2/c1-6-11-8-7-9-16(12(11)10(2)15)13(17)18-14(3,4)5/h10-12H,6-9,15H2,1-5H3/t10-,11?,12?/m0/s1 |
| InChIKey | JVEXNFJUQRMJJL-UNXYVOJBSA-N |
| XLogP | 2.76 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |