About spiro[1,3-benzodioxine-2,1'-cyclooctane]-4-one
spiro[1,3-benzodioxine-2,1'-cyclooctane]-4-one (PubChem CID 172559881) has the molecular formula C15H18O3
and a molecular weight of 246.31 g/mol. Its IUPAC name is spiro[1,3-benzodioxine-2,1'-cyclooctane]-4-one.
Molecular Properties
| Compound Name | spiro[1,3-benzodioxine-2,1'-cyclooctane]-4-one |
| PubChem CID | 172559881 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | spiro[1,3-benzodioxine-2,1'-cyclooctane]-4-one |
| SMILES | O=C1OC2(CCCCCCC2)Oc2ccccc21 |
| InChI | InChI=1S/C15H18O3/c16-14-12-8-4-5-9-13(12)17-15(18-14)10-6-2-1-3-7-11-15/h4-5,8-9H,1-3,6-7,10-11H2 |
| InChIKey | LCSMCMLLQZRSCT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[1,3-benzodioxine-2,1'-cyclooctane]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-benzodioxine-2,1'-cyclooctane]-4-one?
The IUPAC name of spiro[1,3-benzodioxine-2,1'-cyclooctane]-4-one (CID 172559881) is spiro[1,3-benzodioxine-2,1'-cyclooctane]-4-one.
What is the SMILES notation for spiro[1,3-benzodioxine-2,1'-cyclooctane]-4-one?
The canonical SMILES for spiro[1,3-benzodioxine-2,1'-cyclooctane]-4-one is O=C1OC2(CCCCCCC2)Oc2ccccc21.
What is the InChIKey of spiro[1,3-benzodioxine-2,1'-cyclooctane]-4-one?
The InChIKey is LCSMCMLLQZRSCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O3/c16-14-12-8-4-5-9-13(12)17-15(18-14)10-6-2-1-3-7-11-15/h4-5,8-9H,1-3,6-7,10-11H2.
What are the key properties of spiro[1,3-benzodioxine-2,1'-cyclooctane]-4-one?
spiro[1,3-benzodioxine-2,1'-cyclooctane]-4-one has a molecular weight of 246.31 g/mol, XLogP of 3.68, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-benzodioxine-2,1'-cyclooctane]-4-one is sourced from PubChem (CID 172559881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).