About 7-bromo-1,5-dihydropyrrolo[3,2-c]quinolin-4-one
7-bromo-1,5-dihydropyrrolo[3,2-c]quinolin-4-one (PubChem CID 172560088) has the molecular formula C11H7BrN2O
and a molecular weight of 263.09 g/mol. Its IUPAC name is 7-bromo-1,5-dihydropyrrolo[3,2-c]quinolin-4-one.
Molecular Properties
| Compound Name | 7-bromo-1,5-dihydropyrrolo[3,2-c]quinolin-4-one |
| PubChem CID | 172560088 |
| Molecular Formula | C11H7BrN2O |
| Molecular Weight | 263.09 g/mol |
| Exact Mass | 261.97 |
| IUPAC Name | 7-bromo-1,5-dihydropyrrolo[3,2-c]quinolin-4-one |
| SMILES | O=c1[nH]c2cc(Br)ccc2c2[nH]ccc12 |
| InChI | InChI=1S/C11H7BrN2O/c12-6-1-2-7-9(5-6)14-11(15)8-3-4-13-10(7)8/h1-5,13H,(H,14,15) |
| InChIKey | OYRKVXWINZBBMR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.09 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-bromo-1,5-dihydropyrrolo[3,2-c]quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1,5-dihydropyrrolo[3,2-c]quinolin-4-one?
The IUPAC name of 7-bromo-1,5-dihydropyrrolo[3,2-c]quinolin-4-one (CID 172560088) is 7-bromo-1,5-dihydropyrrolo[3,2-c]quinolin-4-one.
What is the SMILES notation for 7-bromo-1,5-dihydropyrrolo[3,2-c]quinolin-4-one?
The canonical SMILES for 7-bromo-1,5-dihydropyrrolo[3,2-c]quinolin-4-one is O=c1[nH]c2cc(Br)ccc2c2[nH]ccc12.
What is the InChIKey of 7-bromo-1,5-dihydropyrrolo[3,2-c]quinolin-4-one?
The InChIKey is OYRKVXWINZBBMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7BrN2O/c12-6-1-2-7-9(5-6)14-11(15)8-3-4-13-10(7)8/h1-5,13H,(H,14,15).
What are the key properties of 7-bromo-1,5-dihydropyrrolo[3,2-c]quinolin-4-one?
7-bromo-1,5-dihydropyrrolo[3,2-c]quinolin-4-one has a molecular weight of 263.09 g/mol, XLogP of 2.77, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1,5-dihydropyrrolo[3,2-c]quinolin-4-one is sourced from PubChem (CID 172560088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).