C12H16BrNO — CID 172560742
N-(3-bromophenyl)-N,2,2-trimethylpropanamide (PubChem CID 172560742) has the molecular formula C12H16BrNO and a molecular weight of 270.17 g/mol. Its IUPAC name is N-(3-bromophenyl)-N,2,2-trimethylpropanamide.
| Compound Name | N-(3-bromophenyl)-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 172560742 |
| Molecular Formula | C12H16BrNO |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | N-(3-bromophenyl)-N,2,2-trimethylpropanamide |
| SMILES | CN(C(=O)C(C)(C)C)c1cccc(Br)c1 |
| InChI | InChI=1S/C12H16BrNO/c1-12(2,3)11(15)14(4)10-7-5-6-9(13)8-10/h5-8H,1-4H3 |
| InChIKey | OMKFYEPSOYOTLW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |