About 5-(2,4-dibromoanilino)-2,4-diphenylimidazol-4-ol
5-(2,4-dibromoanilino)-2,4-diphenylimidazol-4-ol (PubChem CID 172561711) has the molecular formula C21H15Br2N3O
and a molecular weight of 485.18 g/mol. Its IUPAC name is 5-(2,4-dibromoanilino)-2,4-diphenylimidazol-4-ol.
Molecular Properties
| Compound Name | 5-(2,4-dibromoanilino)-2,4-diphenylimidazol-4-ol |
| PubChem CID | 172561711 |
| Molecular Formula | C21H15Br2N3O |
| Molecular Weight | 485.18 g/mol |
| Exact Mass | 482.96 |
| IUPAC Name | 5-(2,4-dibromoanilino)-2,4-diphenylimidazol-4-ol |
| SMILES | OC1(c2ccccc2)N=C(c2ccccc2)N=C1Nc1ccc(Br)cc1Br |
| InChI | InChI=1S/C21H15Br2N3O/c22-16-11-12-18(17(23)13-16)24-20-21(27,15-9-5-2-6-10-15)26-19(25-20)14-7-3-1-4-8-14/h1-13,27H,(H,24,25,26) |
| InChIKey | TTYZHXOVRWQYCR-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 56.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.18 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2,4-dibromoanilino)-2,4-diphenylimidazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-dibromoanilino)-2,4-diphenylimidazol-4-ol?
The IUPAC name of 5-(2,4-dibromoanilino)-2,4-diphenylimidazol-4-ol (CID 172561711) is 5-(2,4-dibromoanilino)-2,4-diphenylimidazol-4-ol.
What is the SMILES notation for 5-(2,4-dibromoanilino)-2,4-diphenylimidazol-4-ol?
The canonical SMILES for 5-(2,4-dibromoanilino)-2,4-diphenylimidazol-4-ol is OC1(c2ccccc2)N=C(c2ccccc2)N=C1Nc1ccc(Br)cc1Br.
What is the InChIKey of 5-(2,4-dibromoanilino)-2,4-diphenylimidazol-4-ol?
The InChIKey is TTYZHXOVRWQYCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15Br2N3O/c22-16-11-12-18(17(23)13-16)24-20-21(27,15-9-5-2-6-10-15)26-19(25-20)14-7-3-1-4-8-14/h1-13,27H,(H,24,25,26).
What are the key properties of 5-(2,4-dibromoanilino)-2,4-diphenylimidazol-4-ol?
5-(2,4-dibromoanilino)-2,4-diphenylimidazol-4-ol has a molecular weight of 485.18 g/mol, XLogP of 5.33, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-dibromoanilino)-2,4-diphenylimidazol-4-ol is sourced from PubChem (CID 172561711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).