C10H14O5 — CID 172561834
2-(3-hydroxy-2-methoxyphenyl)propane-1,1,1-triol (PubChem CID 172561834) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is 2-(3-hydroxy-2-methoxyphenyl)propane-1,1,1-triol.
| Compound Name | 2-(3-hydroxy-2-methoxyphenyl)propane-1,1,1-triol |
|---|---|
| PubChem CID | 172561834 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-(3-hydroxy-2-methoxyphenyl)propane-1,1,1-triol |
| SMILES | COc1c(O)cccc1C(C)C(O)(O)O |
| InChI | InChI=1S/C10H14O5/c1-6(10(12,13)14)7-4-3-5-8(11)9(7)15-2/h3-6,11-14H,1-2H3 |
| InChIKey | HGJHKGJOIDCYDV-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|