About N-methoxy-N-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine-4-carboxamide
N-methoxy-N-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine-4-carboxamide (PubChem CID 172563277) has the molecular formula C9H10F3N3O3
and a molecular weight of 265.19 g/mol. Its IUPAC name is N-methoxy-N-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine-4-carboxamide.
Molecular Properties
| Compound Name | N-methoxy-N-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine-4-carboxamide |
| PubChem CID | 172563277 |
| Molecular Formula | C9H10F3N3O3 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | N-methoxy-N-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine-4-carboxamide |
| SMILES | CON(C)C(=O)c1cc(OCC(F)(F)F)ncn1 |
| InChI | InChI=1S/C9H10F3N3O3/c1-15(17-2)8(16)6-3-7(14-5-13-6)18-4-9(10,11)12/h3,5H,4H2,1-2H3 |
| InChIKey | MYOBCCNQPGZHLI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-N-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-N-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine-4-carboxamide?
The IUPAC name of N-methoxy-N-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine-4-carboxamide (CID 172563277) is N-methoxy-N-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine-4-carboxamide.
What is the SMILES notation for N-methoxy-N-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine-4-carboxamide?
The canonical SMILES for N-methoxy-N-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine-4-carboxamide is CON(C)C(=O)c1cc(OCC(F)(F)F)ncn1.
What is the InChIKey of N-methoxy-N-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine-4-carboxamide?
The InChIKey is MYOBCCNQPGZHLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F3N3O3/c1-15(17-2)8(16)6-3-7(14-5-13-6)18-4-9(10,11)12/h3,5H,4H2,1-2H3.
What are the key properties of N-methoxy-N-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine-4-carboxamide?
N-methoxy-N-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine-4-carboxamide has a molecular weight of 265.19 g/mol, XLogP of 1.05, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-N-methyl-6-(2,2,2-trifluoroethoxy)pyrimidine-4-carboxamide is sourced from PubChem (CID 172563277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).