About 1-[6-(3,3-difluorocyclobutyl)oxypyrimidin-4-yl]-2,2-difluoroethanone
1-[6-(3,3-difluorocyclobutyl)oxypyrimidin-4-yl]-2,2-difluoroethanone (PubChem CID 172563341) has the molecular formula C10H8F4N2O2
and a molecular weight of 264.18 g/mol. Its IUPAC name is 1-[6-(3,3-difluorocyclobutyl)oxypyrimidin-4-yl]-2,2-difluoroethanone.
Molecular Properties
| Compound Name | 1-[6-(3,3-difluorocyclobutyl)oxypyrimidin-4-yl]-2,2-difluoroethanone |
| PubChem CID | 172563341 |
| Molecular Formula | C10H8F4N2O2 |
| Molecular Weight | 264.18 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 1-[6-(3,3-difluorocyclobutyl)oxypyrimidin-4-yl]-2,2-difluoroethanone |
| SMILES | O=C(c1cc(OC2CC(F)(F)C2)ncn1)C(F)F |
| InChI | InChI=1S/C10H8F4N2O2/c11-9(12)8(17)6-1-7(16-4-15-6)18-5-2-10(13,14)3-5/h1,4-5,9H,2-3H2 |
| InChIKey | WAJLWKKJILKOKK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.18 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[6-(3,3-difluorocyclobutyl)oxypyrimidin-4-yl]-2,2-difluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-(3,3-difluorocyclobutyl)oxypyrimidin-4-yl]-2,2-difluoroethanone?
The IUPAC name of 1-[6-(3,3-difluorocyclobutyl)oxypyrimidin-4-yl]-2,2-difluoroethanone (CID 172563341) is 1-[6-(3,3-difluorocyclobutyl)oxypyrimidin-4-yl]-2,2-difluoroethanone.
What is the SMILES notation for 1-[6-(3,3-difluorocyclobutyl)oxypyrimidin-4-yl]-2,2-difluoroethanone?
The canonical SMILES for 1-[6-(3,3-difluorocyclobutyl)oxypyrimidin-4-yl]-2,2-difluoroethanone is O=C(c1cc(OC2CC(F)(F)C2)ncn1)C(F)F.
What is the InChIKey of 1-[6-(3,3-difluorocyclobutyl)oxypyrimidin-4-yl]-2,2-difluoroethanone?
The InChIKey is WAJLWKKJILKOKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F4N2O2/c11-9(12)8(17)6-1-7(16-4-15-6)18-5-2-10(13,14)3-5/h1,4-5,9H,2-3H2.
What are the key properties of 1-[6-(3,3-difluorocyclobutyl)oxypyrimidin-4-yl]-2,2-difluoroethanone?
1-[6-(3,3-difluorocyclobutyl)oxypyrimidin-4-yl]-2,2-difluoroethanone has a molecular weight of 264.18 g/mol, XLogP of 2.10, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-(3,3-difluorocyclobutyl)oxypyrimidin-4-yl]-2,2-difluoroethanone is sourced from PubChem (CID 172563341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).