C16H10ClN5O2S — CID 172564096
3-[3-(7-chloroimidazo[1,2-a]pyridin-2-yl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]benzoic acid (PubChem CID 172564096) has the molecular formula C16H10ClN5O2S and a molecular weight of 371.81 g/mol. Its IUPAC name is 3-[3-(7-chloroimidazo[1,2-a]pyridin-2-yl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]benzoic acid.
| Compound Name | 3-[3-(7-chloroimidazo[1,2-a]pyridin-2-yl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 172564096 |
| Molecular Formula | C16H10ClN5O2S |
| Molecular Weight | 371.81 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | 3-[3-(7-chloroimidazo[1,2-a]pyridin-2-yl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(-n2c(-c3cn4ccc(Cl)cc4n3)n[nH]c2=S)c1 |
| InChI | InChI=1S/C16H10ClN5O2S/c17-10-4-5-21-8-12(18-13(21)7-10)14-19-20-16(25)22(14)11-3-1-2-9(6-11)15(23)24/h1-8H,(H,20,25)(H,23,24) |
| InChIKey | SOKVZFUQYRUEPV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 88.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.81 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|