C22H22N2O2 — CID 172564177
(2S,3S)-2-(4-hydroxyanilino)-N,3-diphenylbutanamide (PubChem CID 172564177) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is (2S,3S)-2-(4-hydroxyanilino)-N,3-diphenylbutanamide.
| Compound Name | (2S,3S)-2-(4-hydroxyanilino)-N,3-diphenylbutanamide |
|---|---|
| PubChem CID | 172564177 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | (2S,3S)-2-(4-hydroxyanilino)-N,3-diphenylbutanamide |
| SMILES | C[C@@H](c1ccccc1)[C@H](Nc1ccc(O)cc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H22N2O2/c1-16(17-8-4-2-5-9-17)21(23-19-12-14-20(25)15-13-19)22(26)24-18-10-6-3-7-11-18/h2-16,21,23,25H,1H3,(H,24,26)/t16-,21-/m0/s1 |
| InChIKey | AXUKPZFKSAEYKQ-KKSFZXQISA-N |
| XLogP | 4.62 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|