C25H22ClF4N5O2 — CID 172564265
(1R,9S)-N-[5-chloro-2-fluoro-4-[4-[methyl(2,2,2-trifluoroethyl)amino]-2-pyridinyl]phenyl]-5-oxo-4,12-diazatricyclo[7.2.1.02,7]dodeca-2,6-diene-12-carboxamide (PubChem CID 172564265) has the molecular formula C25H22ClF4N5O2 and a molecular weight of 535.93 g/mol. Its IUPAC name is (1R,9S)-N-[5-chloro-2-fluoro-4-[4-[methyl(2,2,2-trifluoroethyl)amino]-2-pyridinyl]phenyl]-5-oxo-4,12-diazatricyclo[7.2.1.02,7]dodeca-2,6-diene-12-carboxamide.
| Compound Name | (1R,9S)-N-[5-chloro-2-fluoro-4-[4-[methyl(2,2,2-trifluoroethyl)amino]-2-pyridinyl]phenyl]-5-oxo-4,12-diazatricyclo[7.2.1.02,7]dodeca-2,6-diene-12-carboxamide |
|---|---|
| PubChem CID | 172564265 |
| Molecular Formula | C25H22ClF4N5O2 |
| Molecular Weight | 535.93 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | (1R,9S)-N-[5-chloro-2-fluoro-4-[4-[methyl(2,2,2-trifluoroethyl)amino]-2-pyridinyl]phenyl]-5-oxo-4,12-diazatricyclo[7.2.1.02,7]dodeca-2,6-diene-12-carboxamide |
| SMILES | CN(CC(F)(F)F)c1ccnc(-c2cc(F)c(NC(=O)N3[C@H]4CC[C@@H]3c3c[nH]c(=O)cc3C4)cc2Cl)c1 |
| InChI | InChI=1S/C25H22ClF4N5O2/c1-34(12-25(28,29)30)14-4-5-31-20(8-14)16-9-19(27)21(10-18(16)26)33-24(37)35-15-2-3-22(35)17-11-32-23(36)7-13(17)6-15/h4-5,7-11,15,22H,2-3,6,12H2,1H3,(H,32,36)(H,33,37)/t15-,22+/m0/s1 |
| InChIKey | VWEDYDBLIFWWBK-OYHNWAKOSA-N |
| XLogP | 5.52 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.93 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |