C23H18ClF4N5O3 — CID 172564353
(1R)-N-[5-chloro-2-fluoro-4-[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]phenyl]-5-oxo-4,12-diazatricyclo[7.2.1.02,7]dodeca-2,6-diene-12-carboxamide (PubChem CID 172564353) has the molecular formula C23H18ClF4N5O3 and a molecular weight of 523.87 g/mol. Its IUPAC name is (1R)-N-[5-chloro-2-fluoro-4-[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]phenyl]-5-oxo-4,12-diazatricyclo[7.2.1.02,7]dodeca-2,6-diene-12-carboxamide.
| Compound Name | (1R)-N-[5-chloro-2-fluoro-4-[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]phenyl]-5-oxo-4,12-diazatricyclo[7.2.1.02,7]dodeca-2,6-diene-12-carboxamide |
|---|---|
| PubChem CID | 172564353 |
| Molecular Formula | C23H18ClF4N5O3 |
| Molecular Weight | 523.87 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | (1R)-N-[5-chloro-2-fluoro-4-[6-(2,2,2-trifluoroethoxy)pyridazin-3-yl]phenyl]-5-oxo-4,12-diazatricyclo[7.2.1.02,7]dodeca-2,6-diene-12-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(-c2ccc(OCC(F)(F)F)nn2)cc1F)N1C2CC[C@@H]1c1c[nH]c(=O)cc1C2 |
| InChI | InChI=1S/C23H18ClF4N5O3/c24-15-8-18(16(25)7-13(15)17-2-4-21(32-31-17)36-10-23(26,27)28)30-22(35)33-12-1-3-19(33)14-9-29-20(34)6-11(14)5-12/h2,4,6-9,12,19H,1,3,5,10H2,(H,29,34)(H,30,35)/t12?,19-/m1/s1 |
| InChIKey | QICXIOTYVBXRJH-FKWGRNQDSA-N |
| XLogP | 4.86 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.87 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |