C26H25ClFN5O3 — CID 172564470
(1R,9S)-N-[5-chloro-4-[6-(cyclobutylmethoxy)-3-pyridinyl]-2-fluorophenyl]-5-oxo-3,4,12-triazatricyclo[7.2.1.02,7]dodeca-2,6-diene-12-carboxamide (PubChem CID 172564470) has the molecular formula C26H25ClFN5O3 and a molecular weight of 509.97 g/mol. Its IUPAC name is (1R,9S)-N-[5-chloro-4-[6-(cyclobutylmethoxy)-3-pyridinyl]-2-fluorophenyl]-5-oxo-3,4,12-triazatricyclo[7.2.1.02,7]dodeca-2,6-diene-12-carboxamide.
| Compound Name | (1R,9S)-N-[5-chloro-4-[6-(cyclobutylmethoxy)-3-pyridinyl]-2-fluorophenyl]-5-oxo-3,4,12-triazatricyclo[7.2.1.02,7]dodeca-2,6-diene-12-carboxamide |
|---|---|
| PubChem CID | 172564470 |
| Molecular Formula | C26H25ClFN5O3 |
| Molecular Weight | 509.97 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | (1R,9S)-N-[5-chloro-4-[6-(cyclobutylmethoxy)-3-pyridinyl]-2-fluorophenyl]-5-oxo-3,4,12-triazatricyclo[7.2.1.02,7]dodeca-2,6-diene-12-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(-c2ccc(OCC3CCC3)nc2)cc1F)N1[C@H]2CC[C@@H]1c1n[nH]c(=O)cc1C2 |
| InChI | InChI=1S/C26H25ClFN5O3/c27-19-11-21(20(28)10-18(19)15-4-7-24(29-12-15)36-13-14-2-1-3-14)30-26(35)33-17-5-6-22(33)25-16(8-17)9-23(34)31-32-25/h4,7,9-12,14,17,22H,1-3,5-6,8,13H2,(H,30,35)(H,31,34)/t17-,22+/m0/s1 |
| InChIKey | OGJITQOYYODHFW-HTAPYJJXSA-N |
| XLogP | 5.10 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.97 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |