C11H15F9O — CID 172565145
1,1,1-trifluoro-4-pentoxy-2,2-bis(trifluoromethyl)butane (PubChem CID 172565145) has the molecular formula C11H15F9O and a molecular weight of 334.22 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-pentoxy-2,2-bis(trifluoromethyl)butane.
| Compound Name | 1,1,1-trifluoro-4-pentoxy-2,2-bis(trifluoromethyl)butane |
|---|---|
| PubChem CID | 172565145 |
| Molecular Formula | C11H15F9O |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 1,1,1-trifluoro-4-pentoxy-2,2-bis(trifluoromethyl)butane |
| SMILES | CCCCCOCCC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H15F9O/c1-2-3-4-6-21-7-5-8(9(12,13)14,10(15,16)17)11(18,19)20/h2-7H2,1H3 |
| InChIKey | WKMFDCBFVOKVKC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|