C11H10F14O — CID 172565191
1,1,1,3,3,4,4,5,5,6,6-undecafluoro-9-methoxy-2-(trifluoromethyl)nonane (PubChem CID 172565191) has the molecular formula C11H10F14O and a molecular weight of 424.17 g/mol. Its IUPAC name is 1,1,1,3,3,4,4,5,5,6,6-undecafluoro-9-methoxy-2-(trifluoromethyl)nonane.
| Compound Name | 1,1,1,3,3,4,4,5,5,6,6-undecafluoro-9-methoxy-2-(trifluoromethyl)nonane |
|---|---|
| PubChem CID | 172565191 |
| Molecular Formula | C11H10F14O |
| Molecular Weight | 424.17 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | 1,1,1,3,3,4,4,5,5,6,6-undecafluoro-9-methoxy-2-(trifluoromethyl)nonane |
| SMILES | COCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H10F14O/c1-26-4-2-3-6(12,13)10(22,23)11(24,25)7(14,15)5(8(16,17)18)9(19,20)21/h5H,2-4H2,1H3 |
| InChIKey | GSWQULCFSJZZDJ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.17 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|