C19H22Cl2N2O4S2 — CID 17256532
2,5-dichloro-N-[4-(2-ethylpiperidin-1-yl)sulfonylphenyl]benzenesulfonamide (PubChem CID 17256532) has the molecular formula C19H22Cl2N2O4S2 and a molecular weight of 477.44 g/mol. Its IUPAC name is 2,5-dichloro-N-[4-(2-ethylpiperidin-1-yl)sulfonylphenyl]benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-[4-(2-ethylpiperidin-1-yl)sulfonylphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 17256532 |
| Molecular Formula | C19H22Cl2N2O4S2 |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | 2,5-dichloro-N-[4-(2-ethylpiperidin-1-yl)sulfonylphenyl]benzenesulfonamide |
| SMILES | CCC1CCCCN1S(=O)(=O)c1ccc(NS(=O)(=O)c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C19H22Cl2N2O4S2/c1-2-16-5-3-4-12-23(16)29(26,27)17-9-7-15(8-10-17)22-28(24,25)19-13-14(20)6-11-18(19)21/h6-11,13,16,22H,2-5,12H2,1H3 |
| InChIKey | GUIDMRIFIQUBQR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |