About (4E,5E)-6-(4-butanoylpiperazin-1-yl)-4-ethylideneocta-5,7-dien-3-one;ethane
(4E,5E)-6-(4-butanoylpiperazin-1-yl)-4-ethylideneocta-5,7-dien-3-one;ethane (PubChem CID 172566054) has the molecular formula C20H34N2O2
and a molecular weight of 334.50 g/mol. Its IUPAC name is (4E,5E)-6-(4-butanoylpiperazin-1-yl)-4-ethylideneocta-5,7-dien-3-one;ethane.
Molecular Properties
| Compound Name | (4E,5E)-6-(4-butanoylpiperazin-1-yl)-4-ethylideneocta-5,7-dien-3-one;ethane |
| PubChem CID | 172566054 |
| Molecular Formula | C20H34N2O2 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.26 |
| IUPAC Name | (4E,5E)-6-(4-butanoylpiperazin-1-yl)-4-ethylideneocta-5,7-dien-3-one;ethane |
| SMILES | C=C/C(=C\C(=C/C)C(=O)CC)N1CCN(C(=O)CCC)CC1.CC |
| InChI | InChI=1S/C18H28N2O2.C2H6/c1-5-9-18(22)20-12-10-19(11-13-20)16(7-3)14-15(6-2)17(21)8-4;1-2/h6-7,14H,3,5,8-13H2,1-2,4H3;1-2H3/b15-6+,16-14+; |
| InChIKey | OHEPIDNPXKWTNI-VTXYWQBKSA-N |
| XLogP | 3.95 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E,5E)-6-(4-butanoylpiperazin-1-yl)-4-ethylideneocta-5,7-dien-3-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,5E)-6-(4-butanoylpiperazin-1-yl)-4-ethylideneocta-5,7-dien-3-one;ethane?
The IUPAC name of (4E,5E)-6-(4-butanoylpiperazin-1-yl)-4-ethylideneocta-5,7-dien-3-one;ethane (CID 172566054) is (4E,5E)-6-(4-butanoylpiperazin-1-yl)-4-ethylideneocta-5,7-dien-3-one;ethane.
What is the SMILES notation for (4E,5E)-6-(4-butanoylpiperazin-1-yl)-4-ethylideneocta-5,7-dien-3-one;ethane?
The canonical SMILES for (4E,5E)-6-(4-butanoylpiperazin-1-yl)-4-ethylideneocta-5,7-dien-3-one;ethane is C=C/C(=C\C(=C/C)C(=O)CC)N1CCN(C(=O)CCC)CC1.CC.
What is the InChIKey of (4E,5E)-6-(4-butanoylpiperazin-1-yl)-4-ethylideneocta-5,7-dien-3-one;ethane?
The InChIKey is OHEPIDNPXKWTNI-VTXYWQBKSA-N. The full InChI is InChI=1S/C18H28N2O2.C2H6/c1-5-9-18(22)20-12-10-19(11-13-20)16(7-3)14-15(6-2)17(21)8-4;1-2/h6-7,14H,3,5,8-13H2,1-2,4H3;1-2H3/b15-6+,16-14+;.
What are the key properties of (4E,5E)-6-(4-butanoylpiperazin-1-yl)-4-ethylideneocta-5,7-dien-3-one;ethane?
(4E,5E)-6-(4-butanoylpiperazin-1-yl)-4-ethylideneocta-5,7-dien-3-one;ethane has a molecular weight of 334.50 g/mol, XLogP of 3.95, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,5E)-6-(4-butanoylpiperazin-1-yl)-4-ethylideneocta-5,7-dien-3-one;ethane is sourced from PubChem (CID 172566054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).