C14H12FNO3 — CID 172566220
4-(4-fluoro-3-nitrophenyl)-4-methylcyclohexa-1,5-diene-1-carbaldehyde (PubChem CID 172566220) has the molecular formula C14H12FNO3 and a molecular weight of 261.25 g/mol. Its IUPAC name is 4-(4-fluoro-3-nitrophenyl)-4-methylcyclohexa-1,5-diene-1-carbaldehyde.
| Compound Name | 4-(4-fluoro-3-nitrophenyl)-4-methylcyclohexa-1,5-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 172566220 |
| Molecular Formula | C14H12FNO3 |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 4-(4-fluoro-3-nitrophenyl)-4-methylcyclohexa-1,5-diene-1-carbaldehyde |
| SMILES | CC1(c2ccc(F)c([N+](=O)[O-])c2)C=CC(C=O)=CC1 |
| InChI | InChI=1S/C14H12FNO3/c1-14(6-4-10(9-17)5-7-14)11-2-3-12(15)13(8-11)16(18)19/h2-6,8-9H,7H2,1H3 |
| InChIKey | JKXQQFORGRMNSK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|