About ethane;(E)-4-ethyl-2-N,3-N-dimethyloct-4-ene-2,3-diimine;heptane
ethane;(E)-4-ethyl-2-N,3-N-dimethyloct-4-ene-2,3-diimine;heptane (PubChem CID 172566651) has the molecular formula C21H44N2
and a molecular weight of 324.60 g/mol. Its IUPAC name is ethane;(E)-4-ethyl-2-N,3-N-dimethyloct-4-ene-2,3-diimine;heptane.
Molecular Properties
| Compound Name | ethane;(E)-4-ethyl-2-N,3-N-dimethyloct-4-ene-2,3-diimine;heptane |
| PubChem CID | 172566651 |
| Molecular Formula | C21H44N2 |
| Molecular Weight | 324.60 g/mol |
| Exact Mass | 324.35 |
| IUPAC Name | ethane;(E)-4-ethyl-2-N,3-N-dimethyloct-4-ene-2,3-diimine;heptane |
| SMILES | CC.CCC/C=C(CC)/C(=N/C)C(/C)=N/C.CCCCCCC |
| InChI | InChI=1S/C12H22N2.C7H16.C2H6/c1-6-8-9-11(7-2)12(14-5)10(3)13-4;1-3-5-7-6-4-2;1-2/h9H,6-8H2,1-5H3;3-7H2,1-2H3;1-2H3/b11-9+,13-10+,14-12+;; |
| InChIKey | AWGVBJPVYNCTSO-SRNNVSJDSA-N |
| XLogP | 7.29 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.60 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;(E)-4-ethyl-2-N,3-N-dimethyloct-4-ene-2,3-diimine;heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(E)-4-ethyl-2-N,3-N-dimethyloct-4-ene-2,3-diimine;heptane?
The IUPAC name of ethane;(E)-4-ethyl-2-N,3-N-dimethyloct-4-ene-2,3-diimine;heptane (CID 172566651) is ethane;(E)-4-ethyl-2-N,3-N-dimethyloct-4-ene-2,3-diimine;heptane.
What is the SMILES notation for ethane;(E)-4-ethyl-2-N,3-N-dimethyloct-4-ene-2,3-diimine;heptane?
The canonical SMILES for ethane;(E)-4-ethyl-2-N,3-N-dimethyloct-4-ene-2,3-diimine;heptane is CC.CCC/C=C(CC)/C(=N/C)C(/C)=N/C.CCCCCCC.
What is the InChIKey of ethane;(E)-4-ethyl-2-N,3-N-dimethyloct-4-ene-2,3-diimine;heptane?
The InChIKey is AWGVBJPVYNCTSO-SRNNVSJDSA-N. The full InChI is InChI=1S/C12H22N2.C7H16.C2H6/c1-6-8-9-11(7-2)12(14-5)10(3)13-4;1-3-5-7-6-4-2;1-2/h9H,6-8H2,1-5H3;3-7H2,1-2H3;1-2H3/b11-9+,13-10+,14-12+;;.
What are the key properties of ethane;(E)-4-ethyl-2-N,3-N-dimethyloct-4-ene-2,3-diimine;heptane?
ethane;(E)-4-ethyl-2-N,3-N-dimethyloct-4-ene-2,3-diimine;heptane has a molecular weight of 324.60 g/mol, XLogP of 7.29, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(E)-4-ethyl-2-N,3-N-dimethyloct-4-ene-2,3-diimine;heptane is sourced from PubChem (CID 172566651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).