About but-1-ene;ethane;N-heptyl-N-methylheptan-1-amine
but-1-ene;ethane;N-heptyl-N-methylheptan-1-amine (PubChem CID 172567126) has the molecular formula C21H47N
and a molecular weight of 313.61 g/mol. Its IUPAC name is but-1-ene;ethane;N-heptyl-N-methylheptan-1-amine.
Molecular Properties
| Compound Name | but-1-ene;ethane;N-heptyl-N-methylheptan-1-amine |
| PubChem CID | 172567126 |
| Molecular Formula | C21H47N |
| Molecular Weight | 313.61 g/mol |
| Exact Mass | 313.37 |
| IUPAC Name | but-1-ene;ethane;N-heptyl-N-methylheptan-1-amine |
| SMILES | C=CCC.CC.CCCCCCCN(C)CCCCCCC |
| InChI | InChI=1S/C15H33N.C4H8.C2H6/c1-4-6-8-10-12-14-16(3)15-13-11-9-7-5-2;1-3-4-2;1-2/h4-15H2,1-3H3;3H,1,4H2,2H3;1-2H3 |
| InChIKey | DLLVTEQOTGFJCM-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.61 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-1-ene;ethane;N-heptyl-N-methylheptan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-ene;ethane;N-heptyl-N-methylheptan-1-amine?
The IUPAC name of but-1-ene;ethane;N-heptyl-N-methylheptan-1-amine (CID 172567126) is but-1-ene;ethane;N-heptyl-N-methylheptan-1-amine.
What is the SMILES notation for but-1-ene;ethane;N-heptyl-N-methylheptan-1-amine?
The canonical SMILES for but-1-ene;ethane;N-heptyl-N-methylheptan-1-amine is C=CCC.CC.CCCCCCCN(C)CCCCCCC.
What is the InChIKey of but-1-ene;ethane;N-heptyl-N-methylheptan-1-amine?
The InChIKey is DLLVTEQOTGFJCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33N.C4H8.C2H6/c1-4-6-8-10-12-14-16(3)15-13-11-9-7-5-2;1-3-4-2;1-2/h4-15H2,1-3H3;3H,1,4H2,2H3;1-2H3.
What are the key properties of but-1-ene;ethane;N-heptyl-N-methylheptan-1-amine?
but-1-ene;ethane;N-heptyl-N-methylheptan-1-amine has a molecular weight of 313.61 g/mol, XLogP of 7.47, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-ene;ethane;N-heptyl-N-methylheptan-1-amine is sourced from PubChem (CID 172567126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).